C27H46O6 — CID 162964615
2-[[(2R)-2-hydroxy-3-[(11E,14E)-icosa-11,14-dienoyl]oxypropoxy]methyl]prop-2-enoic acid (PubChem CID 162964615) has the molecular formula C27H46O6 and a molecular weight of 466.66 g/mol. Its IUPAC name is 2-[[(2R)-2-hydroxy-3-[(11E,14E)-icosa-11,14-dienoyl]oxypropoxy]methyl]prop-2-enoic acid.
| Compound Name | 2-[[(2R)-2-hydroxy-3-[(11E,14E)-icosa-11,14-dienoyl]oxypropoxy]methyl]prop-2-enoic acid |
|---|---|
| PubChem CID | 162964615 |
| Molecular Formula | C27H46O6 |
| Molecular Weight | 466.66 g/mol |
| Exact Mass | 466.33 |
| IUPAC Name | 2-[[(2R)-2-hydroxy-3-[(11E,14E)-icosa-11,14-dienoyl]oxypropoxy]methyl]prop-2-enoic acid |
| SMILES | C=C(COC[C@@H](O)COC(=O)CCCCCCCCC/C=C/C/C=C/CCCCC)C(=O)O |
| InChI | InChI=1S/C27H46O6/c1-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18-19-20-26(29)33-23-25(28)22-32-21-24(2)27(30)31/h7-8,10-11,25,28H,2-6,9,12-23H2,1H3,(H,30,31)/b8-7+,11-10+/t25-/m1/s1 |
| InChIKey | QPYZRDNMEPOLSA-NPEQVYCOSA-N |
| XLogP | 6.14 |
| TPSA | 93.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 23 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.66 |
| LogP ≤ 5 | 6.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|