C15H24O2 — CID 162964701
(3aR,4S,8aR)-4-acetyl-5,5,8a-trimethyl-3,3a,4,6,7,8-hexahydro-1H-azulen-2-one (PubChem CID 162964701) has the molecular formula C15H24O2 and a molecular weight of 236.35 g/mol. Its IUPAC name is (3aR,4S,8aR)-4-acetyl-5,5,8a-trimethyl-3,3a,4,6,7,8-hexahydro-1H-azulen-2-one.
| Compound Name | (3aR,4S,8aR)-4-acetyl-5,5,8a-trimethyl-3,3a,4,6,7,8-hexahydro-1H-azulen-2-one |
|---|---|
| PubChem CID | 162964701 |
| Molecular Formula | C15H24O2 |
| Molecular Weight | 236.35 g/mol |
| Exact Mass | 236.18 |
| IUPAC Name | (3aR,4S,8aR)-4-acetyl-5,5,8a-trimethyl-3,3a,4,6,7,8-hexahydro-1H-azulen-2-one |
| SMILES | CC(=O)[C@H]1[C@H]2CC(=O)C[C@@]2(C)CCCC1(C)C |
| InChI | InChI=1S/C15H24O2/c1-10(16)13-12-8-11(17)9-15(12,4)7-5-6-14(13,2)3/h12-13H,5-9H2,1-4H3/t12-,13+,15-/m1/s1 |
| InChIKey | MMKGCZLPPJRCFV-VNHYZAJKSA-N |
| XLogP | 3.39 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 236.35 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |