About N-(2-methylpropyl)undec-3-en-8,10-diynamide
N-(2-methylpropyl)undec-3-en-8,10-diynamide (PubChem CID 162965383) has the molecular formula C15H21NO
and a molecular weight of 231.34 g/mol. Its IUPAC name is N-(2-methylpropyl)undec-3-en-8,10-diynamide.
Molecular Properties
| Compound Name | N-(2-methylpropyl)undec-3-en-8,10-diynamide |
| PubChem CID | 162965383 |
| Molecular Formula | C15H21NO |
| Molecular Weight | 231.34 g/mol |
| Exact Mass | 231.16 |
| IUPAC Name | N-(2-methylpropyl)undec-3-en-8,10-diynamide |
| SMILES | C#CC#CCCCC=CCC(=O)NCC(C)C |
| InChI | InChI=1S/C15H21NO/c1-4-5-6-7-8-9-10-11-12-15(17)16-13-14(2)3/h1,10-11,14H,7-9,12-13H2,2-3H3,(H,16,17) |
| InChIKey | HMMVFLXBFHKMMH-UHFFFAOYSA-N |
| XLogP | 2.51 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 231.34 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze N-(2-methylpropyl)undec-3-en-8,10-diynamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(2-methylpropyl)undec-3-en-8,10-diynamide?
The IUPAC name of N-(2-methylpropyl)undec-3-en-8,10-diynamide (CID 162965383) is N-(2-methylpropyl)undec-3-en-8,10-diynamide.
What is the SMILES notation for N-(2-methylpropyl)undec-3-en-8,10-diynamide?
The canonical SMILES for N-(2-methylpropyl)undec-3-en-8,10-diynamide is C#CC#CCCCC=CCC(=O)NCC(C)C.
What is the InChIKey of N-(2-methylpropyl)undec-3-en-8,10-diynamide?
The InChIKey is HMMVFLXBFHKMMH-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H21NO/c1-4-5-6-7-8-9-10-11-12-15(17)16-13-14(2)3/h1,10-11,14H,7-9,12-13H2,2-3H3,(H,16,17).
What are the key properties of N-(2-methylpropyl)undec-3-en-8,10-diynamide?
N-(2-methylpropyl)undec-3-en-8,10-diynamide has a molecular weight of 231.34 g/mol, XLogP of 2.51, 7 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for N-(2-methylpropyl)undec-3-en-8,10-diynamide is sourced from PubChem (CID 162965383), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).