C24H32O7 — CID 162965665
[(1S,4R,5S,6S,7R,8R)-6-(3,4-dimethoxyphenyl)-4-hydroxy-3,5-dimethoxy-7-methyl-1-prop-2-enyl-8-bicyclo[3.2.1]oct-2-enyl] acetate (PubChem CID 162965665) has the molecular formula C24H32O7 and a molecular weight of 432.51 g/mol. Its IUPAC name is [(1S,4R,5S,6S,7R,8R)-6-(3,4-dimethoxyphenyl)-4-hydroxy-3,5-dimethoxy-7-methyl-1-prop-2-enyl-8-bicyclo[3.2.1]oct-2-enyl] acetate.
| Compound Name | [(1S,4R,5S,6S,7R,8R)-6-(3,4-dimethoxyphenyl)-4-hydroxy-3,5-dimethoxy-7-methyl-1-prop-2-enyl-8-bicyclo[3.2.1]oct-2-enyl] acetate |
|---|---|
| PubChem CID | 162965665 |
| Molecular Formula | C24H32O7 |
| Molecular Weight | 432.51 g/mol |
| Exact Mass | 432.21 |
| IUPAC Name | [(1S,4R,5S,6S,7R,8R)-6-(3,4-dimethoxyphenyl)-4-hydroxy-3,5-dimethoxy-7-methyl-1-prop-2-enyl-8-bicyclo[3.2.1]oct-2-enyl] acetate |
| SMILES | C=CC[C@@]12C=C(OC)[C@@H](O)[C@@](OC)([C@H](c3ccc(OC)c(OC)c3)[C@H]1C)[C@@H]2OC(C)=O |
| InChI | InChI=1S/C24H32O7/c1-8-11-23-13-19(29-6)21(26)24(30-7,22(23)31-15(3)25)20(14(23)2)16-9-10-17(27-4)18(12-16)28-5/h8-10,12-14,20-22,26H,1,11H2,2-7H3/t14-,20+,21-,22-,23-,24+/m1/s1 |
| InChIKey | ONPZKIHRKFLHIX-JSKGSTKVSA-N |
| XLogP | 3.22 |
| TPSA | 83.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.51 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|