C17H20N2O4 — CID 162966643
methyl 3-methyl-2-[(2-methyl-1-oxoisoquinoline-4-carbonyl)amino]butanoate (PubChem CID 162966643) has the molecular formula C17H20N2O4 and a molecular weight of 316.36 g/mol. Its IUPAC name is methyl 3-methyl-2-[(2-methyl-1-oxoisoquinoline-4-carbonyl)amino]butanoate.
| Compound Name | methyl 3-methyl-2-[(2-methyl-1-oxoisoquinoline-4-carbonyl)amino]butanoate |
|---|---|
| PubChem CID | 162966643 |
| Molecular Formula | C17H20N2O4 |
| Molecular Weight | 316.36 g/mol |
| Exact Mass | 316.14 |
| IUPAC Name | methyl 3-methyl-2-[(2-methyl-1-oxoisoquinoline-4-carbonyl)amino]butanoate |
| SMILES | COC(=O)C(NC(=O)c1cn(C)c(=O)c2ccccc12)C(C)C |
| InChI | InChI=1S/C17H20N2O4/c1-10(2)14(17(22)23-4)18-15(20)13-9-19(3)16(21)12-8-6-5-7-11(12)13/h5-10,14H,1-4H3,(H,18,20) |
| InChIKey | YKJOTPNQKCAITF-UHFFFAOYSA-N |
| XLogP | 1.47 |
| TPSA | 77.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.36 |
| LogP ≤ 5 | 1.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |