C21H18O10 — CID 162966763
(2R,3S,4S,5R,6S)-3,4,5-trihydroxy-6-[2-(4-hydroxyphenyl)-4-oxochromen-7-yl]oxyoxane-2-carboxylic acid (PubChem CID 162966763) has the molecular formula C21H18O10 and a molecular weight of 430.37 g/mol. Its IUPAC name is (2R,3S,4S,5R,6S)-3,4,5-trihydroxy-6-[2-(4-hydroxyphenyl)-4-oxochromen-7-yl]oxyoxane-2-carboxylic acid.
| Compound Name | (2R,3S,4S,5R,6S)-3,4,5-trihydroxy-6-[2-(4-hydroxyphenyl)-4-oxochromen-7-yl]oxyoxane-2-carboxylic acid |
|---|---|
| PubChem CID | 162966763 |
| Molecular Formula | C21H18O10 |
| Molecular Weight | 430.37 g/mol |
| Exact Mass | 430.09 |
| IUPAC Name | (2R,3S,4S,5R,6S)-3,4,5-trihydroxy-6-[2-(4-hydroxyphenyl)-4-oxochromen-7-yl]oxyoxane-2-carboxylic acid |
| SMILES | O=C(O)[C@@H]1O[C@@H](Oc2ccc3c(=O)cc(-c4ccc(O)cc4)oc3c2)[C@H](O)[C@@H](O)[C@@H]1O |
| InChI | InChI=1S/C21H18O10/c22-10-3-1-9(2-4-10)14-8-13(23)12-6-5-11(7-15(12)30-14)29-21-18(26)16(24)17(25)19(31-21)20(27)28/h1-8,16-19,21-22,24-26H,(H,27,28)/t16-,17-,18+,19+,21+/m0/s1 |
| InChIKey | OTACUXNJRHHKOW-WXRGLTTHSA-N |
| XLogP | 0.44 |
| TPSA | 166.89 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.37 |
| LogP ≤ 5 | 0.44 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 9 |