C27H38O3 — CID 162967210
2-[(2E,6E,9R,10E)-9-hydroxy-3,7,11,15-tetramethylhexadeca-2,6,10,14-tetraenyl]-6-methylcyclohexa-2,5-diene-1,4-dione (PubChem CID 162967210) has the molecular formula C27H38O3 and a molecular weight of 410.60 g/mol. Its IUPAC name is 2-[(2E,6E,9R,10E)-9-hydroxy-3,7,11,15-tetramethylhexadeca-2,6,10,14-tetraenyl]-6-methylcyclohexa-2,5-diene-1,4-dione.
| Compound Name | 2-[(2E,6E,9R,10E)-9-hydroxy-3,7,11,15-tetramethylhexadeca-2,6,10,14-tetraenyl]-6-methylcyclohexa-2,5-diene-1,4-dione |
|---|---|
| PubChem CID | 162967210 |
| Molecular Formula | C27H38O3 |
| Molecular Weight | 410.60 g/mol |
| Exact Mass | 410.28 |
| IUPAC Name | 2-[(2E,6E,9R,10E)-9-hydroxy-3,7,11,15-tetramethylhexadeca-2,6,10,14-tetraenyl]-6-methylcyclohexa-2,5-diene-1,4-dione |
| SMILES | CC(C)=CCC/C(C)=C/[C@H](O)C/C(C)=C/CC/C(C)=C/CC1=CC(=O)C=C(C)C1=O |
| InChI | InChI=1S/C27H38O3/c1-19(2)9-7-11-21(4)15-25(28)16-22(5)12-8-10-20(3)13-14-24-18-26(29)17-23(6)27(24)30/h9,12-13,15,17-18,25,28H,7-8,10-11,14,16H2,1-6H3/b20-13+,21-15+,22-12+/t25-/m0/s1 |
| InChIKey | ITPMCPADGKSIBU-BRLCAVIXSA-N |
| XLogP | 6.52 |
| TPSA | 54.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.60 |
| LogP ≤ 5 | 6.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'chinone_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|