C14H15NO5 — CID 162967352
(5R,6R,10R)-6-hydroxy-2-methoxy-3-methylidene-10-[(E)-prop-1-enyl]-2-azaspiro[4.5]dec-8-ene-1,4,7-trione (PubChem CID 162967352) has the molecular formula C14H15NO5 and a molecular weight of 277.28 g/mol. Its IUPAC name is (5R,6R,10R)-6-hydroxy-2-methoxy-3-methylidene-10-[(E)-prop-1-enyl]-2-azaspiro[4.5]dec-8-ene-1,4,7-trione.
| Compound Name | (5R,6R,10R)-6-hydroxy-2-methoxy-3-methylidene-10-[(E)-prop-1-enyl]-2-azaspiro[4.5]dec-8-ene-1,4,7-trione |
|---|---|
| PubChem CID | 162967352 |
| Molecular Formula | C14H15NO5 |
| Molecular Weight | 277.28 g/mol |
| Exact Mass | 277.10 |
| IUPAC Name | (5R,6R,10R)-6-hydroxy-2-methoxy-3-methylidene-10-[(E)-prop-1-enyl]-2-azaspiro[4.5]dec-8-ene-1,4,7-trione |
| SMILES | C=C1C(=O)[C@@]2(C(=O)N1OC)[C@H](/C=C/C)C=CC(=O)[C@@H]2O |
| InChI | InChI=1S/C14H15NO5/c1-4-5-9-6-7-10(16)12(18)14(9)11(17)8(2)15(20-3)13(14)19/h4-7,9,12,18H,2H2,1,3H3/b5-4+/t9-,12+,14+/m1/s1 |
| InChIKey | QTOYKROMBAULCV-KANDOSDCSA-N |
| XLogP | 0.15 |
| TPSA | 83.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.28 |
| LogP ≤ 5 | 0.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|