C13H20O4 — CID 162967702
(3S,3aS,4S,7R,10E,11aS)-4,7-dihydroxy-3-methyl-3a,4,5,6,7,8,9,11a-octahydro-3H-cyclodeca[b]furan-2-one (PubChem CID 162967702) has the molecular formula C13H20O4 and a molecular weight of 240.30 g/mol. Its IUPAC name is (3S,3aS,4S,7R,10E,11aS)-4,7-dihydroxy-3-methyl-3a,4,5,6,7,8,9,11a-octahydro-3H-cyclodeca[b]furan-2-one.
| Compound Name | (3S,3aS,4S,7R,10E,11aS)-4,7-dihydroxy-3-methyl-3a,4,5,6,7,8,9,11a-octahydro-3H-cyclodeca[b]furan-2-one |
|---|---|
| PubChem CID | 162967702 |
| Molecular Formula | C13H20O4 |
| Molecular Weight | 240.30 g/mol |
| Exact Mass | 240.14 |
| IUPAC Name | (3S,3aS,4S,7R,10E,11aS)-4,7-dihydroxy-3-methyl-3a,4,5,6,7,8,9,11a-octahydro-3H-cyclodeca[b]furan-2-one |
| SMILES | C[C@@H]1C(=O)O[C@H]2/C=C/CC[C@@H](O)CC[C@H](O)[C@@H]21 |
| InChI | InChI=1S/C13H20O4/c1-8-12-10(15)7-6-9(14)4-2-3-5-11(12)17-13(8)16/h3,5,8-12,14-15H,2,4,6-7H2,1H3/b5-3+/t8-,9+,10-,11-,12-/m0/s1 |
| InChIKey | NRJBCHONNAYGLK-YGBFRMIDSA-N |
| XLogP | 1.02 |
| TPSA | 66.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.30 |
| LogP ≤ 5 | 1.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|