C15H24O — CID 162967750
(1R,4E,8R,9S)-4,11,11-trimethylspiro[bicyclo[7.2.0]undec-4-ene-8,2'-oxirane] (PubChem CID 162967750) has the molecular formula C15H24O and a molecular weight of 220.36 g/mol. Its IUPAC name is (1R,4E,8R,9S)-4,11,11-trimethylspiro[bicyclo[7.2.0]undec-4-ene-8,2'-oxirane].
| Compound Name | (1R,4E,8R,9S)-4,11,11-trimethylspiro[bicyclo[7.2.0]undec-4-ene-8,2'-oxirane] |
|---|---|
| PubChem CID | 162967750 |
| Molecular Formula | C15H24O |
| Molecular Weight | 220.36 g/mol |
| Exact Mass | 220.18 |
| IUPAC Name | (1R,4E,8R,9S)-4,11,11-trimethylspiro[bicyclo[7.2.0]undec-4-ene-8,2'-oxirane] |
| SMILES | C/C1=C\CC[C@]2(CO2)[C@H]2CC(C)(C)[C@@H]2CC1 |
| InChI | InChI=1S/C15H24O/c1-11-5-4-8-15(10-16-15)13-9-14(2,3)12(13)7-6-11/h5,12-13H,4,6-10H2,1-3H3/b11-5+/t12-,13+,15+/m1/s1 |
| InChIKey | AURKDPLYMRHYAY-USNDISCDSA-N |
| XLogP | 3.94 |
| TPSA | 12.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 220.36 |
| LogP ≤ 5 | 3.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|