C20H30O8 — CID 162967789
[6-(6-hydroperoxy-6-methyl-3-oxohepta-1,4-dien-2-yl)-3,4-dihydroxy-3-methyl-2-oxocyclohexyl] 3-methylbutanoate (PubChem CID 162967789) has the molecular formula C20H30O8 and a molecular weight of 398.45 g/mol. Its IUPAC name is [6-(6-hydroperoxy-6-methyl-3-oxohepta-1,4-dien-2-yl)-3,4-dihydroxy-3-methyl-2-oxocyclohexyl] 3-methylbutanoate.
| Compound Name | [6-(6-hydroperoxy-6-methyl-3-oxohepta-1,4-dien-2-yl)-3,4-dihydroxy-3-methyl-2-oxocyclohexyl] 3-methylbutanoate |
|---|---|
| PubChem CID | 162967789 |
| Molecular Formula | C20H30O8 |
| Molecular Weight | 398.45 g/mol |
| Exact Mass | 398.19 |
| IUPAC Name | [6-(6-hydroperoxy-6-methyl-3-oxohepta-1,4-dien-2-yl)-3,4-dihydroxy-3-methyl-2-oxocyclohexyl] 3-methylbutanoate |
| SMILES | C=C(C(=O)C=CC(C)(C)OO)C1CC(O)C(C)(O)C(=O)C1OC(=O)CC(C)C |
| InChI | InChI=1S/C20H30O8/c1-11(2)9-16(23)27-17-13(10-15(22)20(6,25)18(17)24)12(3)14(21)7-8-19(4,5)28-26/h7-8,11,13,15,17,22,25-26H,3,9-10H2,1-2,4-6H3 |
| InChIKey | QTXRYOLCFIXJOO-UHFFFAOYSA-N |
| XLogP | 1.59 |
| TPSA | 130.36 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.45 |
| LogP ≤ 5 | 1.59 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|