C29H48O2 — CID 162968003
(4aS,6aR,6aS,6bR,8aS,12aS,14bS)-2,2,6a,6b,9,9,12a-heptamethyl-1,3,4,5,6,6a,7,8,8a,10,11,12,13,14b-tetradecahydropicene-4a,14-diol (PubChem CID 162968003) has the molecular formula C29H48O2 and a molecular weight of 428.70 g/mol. Its IUPAC name is (4aS,6aR,6aS,6bR,8aS,12aS,14bS)-2,2,6a,6b,9,9,12a-heptamethyl-1,3,4,5,6,6a,7,8,8a,10,11,12,13,14b-tetradecahydropicene-4a,14-diol.
| Compound Name | (4aS,6aR,6aS,6bR,8aS,12aS,14bS)-2,2,6a,6b,9,9,12a-heptamethyl-1,3,4,5,6,6a,7,8,8a,10,11,12,13,14b-tetradecahydropicene-4a,14-diol |
|---|---|
| PubChem CID | 162968003 |
| Molecular Formula | C29H48O2 |
| Molecular Weight | 428.70 g/mol |
| Exact Mass | 428.37 |
| IUPAC Name | (4aS,6aR,6aS,6bR,8aS,12aS,14bS)-2,2,6a,6b,9,9,12a-heptamethyl-1,3,4,5,6,6a,7,8,8a,10,11,12,13,14b-tetradecahydropicene-4a,14-diol |
| SMILES | CC1(C)CC[C@]2(O)CC[C@]3(C)C(=C(O)C[C@@H]4[C@@]5(C)CCCC(C)(C)[C@@H]5CC[C@]43C)[C@@H]2C1 |
| InChI | InChI=1S/C29H48O2/c1-24(2)13-15-29(31)16-14-28(7)23(19(29)18-24)20(30)17-22-26(5)11-8-10-25(3,4)21(26)9-12-27(22,28)6/h19,21-22,30-31H,8-18H2,1-7H3/t19-,21-,22+,26-,27+,28+,29-/m0/s1 |
| InChIKey | NICCBUMXGAHGGH-VMNJZLRASA-N |
| XLogP | 7.81 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.70 |
| LogP ≤ 5 | 7.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |