C28H40O3 — CID 162968731
2-[(2E,6E,9E,11R)-11-methoxy-3,7,11,15-tetramethylhexadeca-2,6,9,14-tetraenyl]-6-methylcyclohexa-2,5-diene-1,4-dione (PubChem CID 162968731) has the molecular formula C28H40O3 and a molecular weight of 424.63 g/mol. Its IUPAC name is 2-[(2E,6E,9E,11R)-11-methoxy-3,7,11,15-tetramethylhexadeca-2,6,9,14-tetraenyl]-6-methylcyclohexa-2,5-diene-1,4-dione.
| Compound Name | 2-[(2E,6E,9E,11R)-11-methoxy-3,7,11,15-tetramethylhexadeca-2,6,9,14-tetraenyl]-6-methylcyclohexa-2,5-diene-1,4-dione |
|---|---|
| PubChem CID | 162968731 |
| Molecular Formula | C28H40O3 |
| Molecular Weight | 424.63 g/mol |
| Exact Mass | 424.30 |
| IUPAC Name | 2-[(2E,6E,9E,11R)-11-methoxy-3,7,11,15-tetramethylhexadeca-2,6,9,14-tetraenyl]-6-methylcyclohexa-2,5-diene-1,4-dione |
| SMILES | CO[C@@](C)(/C=C/C/C(C)=C/CC/C(C)=C/CC1=CC(=O)C=C(C)C1=O)CCC=C(C)C |
| InChI | InChI=1S/C28H40O3/c1-21(2)11-9-17-28(6,31-7)18-10-14-22(3)12-8-13-23(4)15-16-25-20-26(29)19-24(5)27(25)30/h10-12,15,18-20H,8-9,13-14,16-17H2,1-7H3/b18-10+,22-12+,23-15+/t28-/m1/s1 |
| InChIKey | XRHIGWQFMLXJDO-PUJKICBXSA-N |
| XLogP | 7.17 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.63 |
| LogP ≤ 5 | 7.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'chinone_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|