C15H20O4 — CID 162968824
(6S,6aS,9aR,9bR)-3-(hydroxymethyl)-6,9a-dimethyl-5,6,6a,7,8,9b-hexahydro-4H-azuleno[8,7-b]furan-2,9-dione (PubChem CID 162968824) has the molecular formula C15H20O4 and a molecular weight of 264.32 g/mol. Its IUPAC name is (6S,6aS,9aR,9bR)-3-(hydroxymethyl)-6,9a-dimethyl-5,6,6a,7,8,9b-hexahydro-4H-azuleno[8,7-b]furan-2,9-dione.
| Compound Name | (6S,6aS,9aR,9bR)-3-(hydroxymethyl)-6,9a-dimethyl-5,6,6a,7,8,9b-hexahydro-4H-azuleno[8,7-b]furan-2,9-dione |
|---|---|
| PubChem CID | 162968824 |
| Molecular Formula | C15H20O4 |
| Molecular Weight | 264.32 g/mol |
| Exact Mass | 264.14 |
| IUPAC Name | (6S,6aS,9aR,9bR)-3-(hydroxymethyl)-6,9a-dimethyl-5,6,6a,7,8,9b-hexahydro-4H-azuleno[8,7-b]furan-2,9-dione |
| SMILES | C[C@H]1CCC2=C(CO)C(=O)O[C@H]2[C@]2(C)C(=O)CC[C@@H]12 |
| InChI | InChI=1S/C15H20O4/c1-8-3-4-9-10(7-16)14(18)19-13(9)15(2)11(8)5-6-12(15)17/h8,11,13,16H,3-7H2,1-2H3/t8-,11-,13+,15-/m0/s1 |
| InChIKey | SQBLZGPDZBFVEE-BUWBAVOPSA-N |
| XLogP | 1.62 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.32 |
| LogP ≤ 5 | 1.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |