C25H47NO6 — CID 162969060
[(E,2R,3S,6R)-3,6-dihydroxy-2-[[(2R)-2-hydroxydodecanoyl]amino]undec-4-enyl] acetate (PubChem CID 162969060) has the molecular formula C25H47NO6 and a molecular weight of 457.65 g/mol. Its IUPAC name is [(E,2R,3S,6R)-3,6-dihydroxy-2-[[(2R)-2-hydroxydodecanoyl]amino]undec-4-enyl] acetate.
| Compound Name | [(E,2R,3S,6R)-3,6-dihydroxy-2-[[(2R)-2-hydroxydodecanoyl]amino]undec-4-enyl] acetate |
|---|---|
| PubChem CID | 162969060 |
| Molecular Formula | C25H47NO6 |
| Molecular Weight | 457.65 g/mol |
| Exact Mass | 457.34 |
| IUPAC Name | [(E,2R,3S,6R)-3,6-dihydroxy-2-[[(2R)-2-hydroxydodecanoyl]amino]undec-4-enyl] acetate |
| SMILES | CCCCCCCCCC[C@@H](O)C(=O)N[C@H](COC(C)=O)[C@@H](O)/C=C/[C@H](O)CCCCC |
| InChI | InChI=1S/C25H47NO6/c1-4-6-8-9-10-11-12-14-16-24(30)25(31)26-22(19-32-20(3)27)23(29)18-17-21(28)15-13-7-5-2/h17-18,21-24,28-30H,4-16,19H2,1-3H3,(H,26,31)/b18-17+/t21-,22-,23+,24-/m1/s1 |
| InChIKey | XRODLBXBYOICFZ-NUAHHSSHSA-N |
| XLogP | 3.78 |
| TPSA | 116.09 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.65 |
| LogP ≤ 5 | 3.78 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|