C21H28O7 — CID 162969149
(1E,4S,5R,8S,13R,16S,19R,21S,22R)-21-hydroperoxy-8-hydroxy-5,19-dimethyl-15,18,20-trioxapentacyclo[14.5.1.04,13.05,10.019,22]docosa-1,10-dien-14-one (PubChem CID 162969149) has the molecular formula C21H28O7 and a molecular weight of 392.45 g/mol. Its IUPAC name is (1E,4S,5R,8S,13R,16S,19R,21S,22R)-21-hydroperoxy-8-hydroxy-5,19-dimethyl-15,18,20-trioxapentacyclo[14.5.1.04,13.05,10.019,22]docosa-1,10-dien-14-one.
| Compound Name | (1E,4S,5R,8S,13R,16S,19R,21S,22R)-21-hydroperoxy-8-hydroxy-5,19-dimethyl-15,18,20-trioxapentacyclo[14.5.1.04,13.05,10.019,22]docosa-1,10-dien-14-one |
|---|---|
| PubChem CID | 162969149 |
| Molecular Formula | C21H28O7 |
| Molecular Weight | 392.45 g/mol |
| Exact Mass | 392.18 |
| IUPAC Name | (1E,4S,5R,8S,13R,16S,19R,21S,22R)-21-hydroperoxy-8-hydroxy-5,19-dimethyl-15,18,20-trioxapentacyclo[14.5.1.04,13.05,10.019,22]docosa-1,10-dien-14-one |
| SMILES | C[C@@]12OC[C@H]3OC(=O)[C@@H]4CC=C5C[C@@H](O)CC[C@]5(C)[C@H]4C/C=C(/[C@H](OO)O1)[C@H]32 |
| InChI | InChI=1S/C21H28O7/c1-20-8-7-12(22)9-11(20)3-4-13-15(20)6-5-14-17-16(26-18(13)23)10-25-21(17,2)27-19(14)28-24/h3,5,12-13,15-17,19,22,24H,4,6-10H2,1-2H3/b14-5+/t12-,13+,15-,16+,17+,19-,20-,21+/m0/s1 |
| InChIKey | RUHYVNDSXWCFOW-VPNZEDHFSA-N |
| XLogP | 2.55 |
| TPSA | 94.45 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.45 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|