C15H24O4 — CID 162969742
(3R,3aS,6R,6aS,9R,10S,10aS)-9,10-dihydroxy-3,6,9-trimethyl-3a,4,5,6,6a,7,8,10-octahydro-3H-benzo[h][1]benzofuran-2-one (PubChem CID 162969742) has the molecular formula C15H24O4 and a molecular weight of 268.35 g/mol. Its IUPAC name is (3R,3aS,6R,6aS,9R,10S,10aS)-9,10-dihydroxy-3,6,9-trimethyl-3a,4,5,6,6a,7,8,10-octahydro-3H-benzo[h][1]benzofuran-2-one.
| Compound Name | (3R,3aS,6R,6aS,9R,10S,10aS)-9,10-dihydroxy-3,6,9-trimethyl-3a,4,5,6,6a,7,8,10-octahydro-3H-benzo[h][1]benzofuran-2-one |
|---|---|
| PubChem CID | 162969742 |
| Molecular Formula | C15H24O4 |
| Molecular Weight | 268.35 g/mol |
| Exact Mass | 268.17 |
| IUPAC Name | (3R,3aS,6R,6aS,9R,10S,10aS)-9,10-dihydroxy-3,6,9-trimethyl-3a,4,5,6,6a,7,8,10-octahydro-3H-benzo[h][1]benzofuran-2-one |
| SMILES | C[C@@H]1CC[C@H]2[C@@H](C)C(=O)O[C@]23[C@@H](O)[C@](C)(O)CC[C@@H]13 |
| InChI | InChI=1S/C15H24O4/c1-8-4-5-11-9(2)12(16)19-15(11)10(8)6-7-14(3,18)13(15)17/h8-11,13,17-18H,4-7H2,1-3H3/t8-,9-,10+,11+,13+,14-,15+/m1/s1 |
| InChIKey | FONFQQKKCDVNRC-HEDVPHRJSA-N |
| XLogP | 1.49 |
| TPSA | 66.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.35 |
| LogP ≤ 5 | 1.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |