C17H28O4 — CID 162970266
[(2Z,6E)-8-acetyloxy-2,6-dimethylocta-2,6-dienyl] (2R)-2-methylbutanoate (PubChem CID 162970266) has the molecular formula C17H28O4 and a molecular weight of 296.41 g/mol. Its IUPAC name is [(2Z,6E)-8-acetyloxy-2,6-dimethylocta-2,6-dienyl] (2R)-2-methylbutanoate.
| Compound Name | [(2Z,6E)-8-acetyloxy-2,6-dimethylocta-2,6-dienyl] (2R)-2-methylbutanoate |
|---|---|
| PubChem CID | 162970266 |
| Molecular Formula | C17H28O4 |
| Molecular Weight | 296.41 g/mol |
| Exact Mass | 296.20 |
| IUPAC Name | [(2Z,6E)-8-acetyloxy-2,6-dimethylocta-2,6-dienyl] (2R)-2-methylbutanoate |
| SMILES | CC[C@@H](C)C(=O)OC/C(C)=C\CC/C(C)=C/COC(C)=O |
| InChI | InChI=1S/C17H28O4/c1-6-15(4)17(19)21-12-14(3)9-7-8-13(2)10-11-20-16(5)18/h9-10,15H,6-8,11-12H2,1-5H3/b13-10+,14-9-/t15-/m1/s1 |
| InChIKey | WEBJVWPPMGGELG-SVXHRKKWSA-N |
| XLogP | 3.81 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.41 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|