C14H20O5 — CID 162970392
methyl (2R,3E)-2-hydroxy-3-[(2R,4S,5S)-4-hydroxy-2,5-bis[(E)-prop-1-enyl]oxolan-3-ylidene]propanoate (PubChem CID 162970392) has the molecular formula C14H20O5 and a molecular weight of 268.31 g/mol. Its IUPAC name is methyl (2R,3E)-2-hydroxy-3-[(2R,4S,5S)-4-hydroxy-2,5-bis[(E)-prop-1-enyl]oxolan-3-ylidene]propanoate.
| Compound Name | methyl (2R,3E)-2-hydroxy-3-[(2R,4S,5S)-4-hydroxy-2,5-bis[(E)-prop-1-enyl]oxolan-3-ylidene]propanoate |
|---|---|
| PubChem CID | 162970392 |
| Molecular Formula | C14H20O5 |
| Molecular Weight | 268.31 g/mol |
| Exact Mass | 268.13 |
| IUPAC Name | methyl (2R,3E)-2-hydroxy-3-[(2R,4S,5S)-4-hydroxy-2,5-bis[(E)-prop-1-enyl]oxolan-3-ylidene]propanoate |
| SMILES | C/C=C/[C@@H]1O[C@H](/C=C/C)/C(=C/[C@@H](O)C(=O)OC)[C@@H]1O |
| InChI | InChI=1S/C14H20O5/c1-4-6-11-9(8-10(15)14(17)18-3)13(16)12(19-11)7-5-2/h4-8,10-13,15-16H,1-3H3/b6-4+,7-5+,9-8-/t10-,11-,12+,13+/m1/s1 |
| InChIKey | DMRIUUMAZLWLQW-YPLQYVOVSA-N |
| XLogP | 0.73 |
| TPSA | 75.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.31 |
| LogP ≤ 5 | 0.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|