C40H74 — CID 162970843
2,8-dimethyl-6-(6,10,14,18,22-pentamethyltricos-1-en-2-yl)tricyclo[5.3.0.02,5]decane (PubChem CID 162970843) has the molecular formula C40H74 and a molecular weight of 555.03 g/mol. Its IUPAC name is 2,8-dimethyl-6-(6,10,14,18,22-pentamethyltricos-1-en-2-yl)tricyclo[5.3.0.02,5]decane.
| Compound Name | 2,8-dimethyl-6-(6,10,14,18,22-pentamethyltricos-1-en-2-yl)tricyclo[5.3.0.02,5]decane |
|---|---|
| PubChem CID | 162970843 |
| Molecular Formula | C40H74 |
| Molecular Weight | 555.03 g/mol |
| Exact Mass | 554.58 |
| IUPAC Name | 2,8-dimethyl-6-(6,10,14,18,22-pentamethyltricos-1-en-2-yl)tricyclo[5.3.0.02,5]decane |
| SMILES | C=C(CCCC(C)CCCC(C)CCCC(C)CCCC(C)CCCC(C)C)C1C2C(C)CCC2C2(C)CCC12 |
| InChI | InChI=1S/C40H74/c1-29(2)15-10-16-30(3)17-11-18-31(4)19-12-20-32(5)21-13-22-33(6)23-14-24-34(7)38-37-27-28-40(37,9)36-26-25-35(8)39(36)38/h29-33,35-39H,7,10-28H2,1-6,8-9H3 |
| InChIKey | QBUWYPSTNDPQKI-UHFFFAOYSA-N |
| XLogP | 13.30 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 21 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 555.03 |
| LogP ≤ 5 | 13.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|