C23H36O6 — CID 162971054
(1S,4aR,5R,8aS)-5-[(3R)-1-(3-carboxypropanoyloxy)pentan-3-yl]-1,4a-dimethyl-6-methylidene-3,4,5,7,8,8a-hexahydro-2H-naphthalene-1-carboxylic acid (PubChem CID 162971054) has the molecular formula C23H36O6 and a molecular weight of 408.54 g/mol. Its IUPAC name is (1S,4aR,5R,8aS)-5-[(3R)-1-(3-carboxypropanoyloxy)pentan-3-yl]-1,4a-dimethyl-6-methylidene-3,4,5,7,8,8a-hexahydro-2H-naphthalene-1-carboxylic acid.
| Compound Name | (1S,4aR,5R,8aS)-5-[(3R)-1-(3-carboxypropanoyloxy)pentan-3-yl]-1,4a-dimethyl-6-methylidene-3,4,5,7,8,8a-hexahydro-2H-naphthalene-1-carboxylic acid |
|---|---|
| PubChem CID | 162971054 |
| Molecular Formula | C23H36O6 |
| Molecular Weight | 408.54 g/mol |
| Exact Mass | 408.25 |
| IUPAC Name | (1S,4aR,5R,8aS)-5-[(3R)-1-(3-carboxypropanoyloxy)pentan-3-yl]-1,4a-dimethyl-6-methylidene-3,4,5,7,8,8a-hexahydro-2H-naphthalene-1-carboxylic acid |
| SMILES | C=C1CC[C@H]2[C@@](C)(CCC[C@]2(C)C(=O)O)[C@@H]1C(CC)CCOC(=O)CCC(=O)O |
| InChI | InChI=1S/C23H36O6/c1-5-16(11-14-29-19(26)10-9-18(24)25)20-15(2)7-8-17-22(20,3)12-6-13-23(17,4)21(27)28/h16-17,20H,2,5-14H2,1,3-4H3,(H,24,25)(H,27,28)/t16?,17-,20-,22+,23-/m0/s1 |
| InChIKey | SATJIOXKIKLNFD-XKTMUDHNSA-N |
| XLogP | 4.67 |
| TPSA | 100.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.54 |
| LogP ≤ 5 | 4.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|