C31H42O11 — CID 162971241
[13-hydroxy-10-(1-hydroxyethyl)-14,21,25-trimethyl-5,16-dioxospiro[4,11,17,27-tetraoxatetracyclo[21.3.1.03,25.019,24]heptacosa-6,8,21-triene-26,2'-oxirane]-14-yl] acetate (PubChem CID 162971241) has the molecular formula C31H42O11 and a molecular weight of 590.67 g/mol. Its IUPAC name is [13-hydroxy-10-(1-hydroxyethyl)-14,21,25-trimethyl-5,16-dioxospiro[4,11,17,27-tetraoxatetracyclo[21.3.1.03,25.019,24]heptacosa-6,8,21-triene-26,2'-oxirane]-14-yl] acetate.
| Compound Name | [13-hydroxy-10-(1-hydroxyethyl)-14,21,25-trimethyl-5,16-dioxospiro[4,11,17,27-tetraoxatetracyclo[21.3.1.03,25.019,24]heptacosa-6,8,21-triene-26,2'-oxirane]-14-yl] acetate |
|---|---|
| PubChem CID | 162971241 |
| Molecular Formula | C31H42O11 |
| Molecular Weight | 590.67 g/mol |
| Exact Mass | 590.27 |
| IUPAC Name | [13-hydroxy-10-(1-hydroxyethyl)-14,21,25-trimethyl-5,16-dioxospiro[4,11,17,27-tetraoxatetracyclo[21.3.1.03,25.019,24]heptacosa-6,8,21-triene-26,2'-oxirane]-14-yl] acetate |
| SMILES | CC(=O)OC1(C)CC(=O)OCC2CC(C)=CC3OC4CC(OC(=O)C=CC=CC(C(C)O)OCC1O)C(C)(C23)C41CO1 |
| InChI | InChI=1S/C31H42O11/c1-17-10-20-14-38-27(36)13-29(4,42-19(3)33)23(34)15-37-21(18(2)32)8-6-7-9-26(35)41-24-12-25-31(16-39-31)30(24,5)28(20)22(11-17)40-25/h6-9,11,18,20-25,28,32,34H,10,12-16H2,1-5H3 |
| InChIKey | IGEIWSJAFZWQKA-UHFFFAOYSA-N |
| XLogP | 1.93 |
| TPSA | 150.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 590.67 |
| LogP ≤ 5 | 1.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|