C5H11N3O2 — CID 162971297
(3R,4R,5S)-3,4-diamino-5-(aminomethyl)oxolan-2-one (PubChem CID 162971297) has the molecular formula C5H11N3O2 and a molecular weight of 145.16 g/mol. Its IUPAC name is (3R,4R,5S)-3,4-diamino-5-(aminomethyl)oxolan-2-one.
| Compound Name | (3R,4R,5S)-3,4-diamino-5-(aminomethyl)oxolan-2-one |
|---|---|
| PubChem CID | 162971297 |
| Molecular Formula | C5H11N3O2 |
| Molecular Weight | 145.16 g/mol |
| Exact Mass | 145.09 |
| IUPAC Name | (3R,4R,5S)-3,4-diamino-5-(aminomethyl)oxolan-2-one |
| SMILES | NC[C@@H]1OC(=O)[C@H](N)[C@H]1N |
| InChI | InChI=1S/C5H11N3O2/c6-1-2-3(7)4(8)5(9)10-2/h2-4H,1,6-8H2/t2-,3-,4+/m0/s1 |
| InChIKey | DVELXLKFMZFAEV-YVZJFKFKSA-N |
| XLogP | -2.47 |
| TPSA | 104.36 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 145.16 |
| LogP ≤ 5 | -2.47 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |