C28H44O5 — CID 162971437
[(1R,2R,3S,5S,7R,8S,11R,12S,14E,17R)-5,8,11,15-tetramethyl-4-oxo-10,18-dioxatetracyclo[9.7.0.02,7.03,17]octadec-14-en-12-yl] octanoate (PubChem CID 162971437) has the molecular formula C28H44O5 and a molecular weight of 460.66 g/mol. Its IUPAC name is [(1R,2R,3S,5S,7R,8S,11R,12S,14E,17R)-5,8,11,15-tetramethyl-4-oxo-10,18-dioxatetracyclo[9.7.0.02,7.03,17]octadec-14-en-12-yl] octanoate.
| Compound Name | [(1R,2R,3S,5S,7R,8S,11R,12S,14E,17R)-5,8,11,15-tetramethyl-4-oxo-10,18-dioxatetracyclo[9.7.0.02,7.03,17]octadec-14-en-12-yl] octanoate |
|---|---|
| PubChem CID | 162971437 |
| Molecular Formula | C28H44O5 |
| Molecular Weight | 460.66 g/mol |
| Exact Mass | 460.32 |
| IUPAC Name | [(1R,2R,3S,5S,7R,8S,11R,12S,14E,17R)-5,8,11,15-tetramethyl-4-oxo-10,18-dioxatetracyclo[9.7.0.02,7.03,17]octadec-14-en-12-yl] octanoate |
| SMILES | CCCCCCCC(=O)O[C@H]1C/C=C(/C)C[C@H]2O[C@@H]3[C@@H]4[C@H](C[C@H](C)C(=O)[C@@H]42)[C@H](C)CO[C@]13C |
| InChI | InChI=1S/C28H44O5/c1-6-7-8-9-10-11-23(29)33-22-13-12-17(2)14-21-25-24-20(15-18(3)26(25)30)19(4)16-31-28(22,5)27(24)32-21/h12,18-22,24-25,27H,6-11,13-16H2,1-5H3/b17-12-/t18-,19+,20+,21+,22-,24+,25+,27+,28+/m0/s1 |
| InChIKey | DYSXWOGOOCJDGH-LLEAXDPJSA-N |
| XLogP | 5.65 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.66 |
| LogP ≤ 5 | 5.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|