C19H28O2 — CID 162971493
(1S,4R,9R,10R,13R,14S)-9-methyl-5-methylidenetetracyclo[11.2.1.01,10.04,9]hexadecane-14-carboxylic acid (PubChem CID 162971493) has the molecular formula C19H28O2 and a molecular weight of 288.43 g/mol. Its IUPAC name is (1S,4R,9R,10R,13R,14S)-9-methyl-5-methylidenetetracyclo[11.2.1.01,10.04,9]hexadecane-14-carboxylic acid.
| Compound Name | (1S,4R,9R,10R,13R,14S)-9-methyl-5-methylidenetetracyclo[11.2.1.01,10.04,9]hexadecane-14-carboxylic acid |
|---|---|
| PubChem CID | 162971493 |
| Molecular Formula | C19H28O2 |
| Molecular Weight | 288.43 g/mol |
| Exact Mass | 288.21 |
| IUPAC Name | (1S,4R,9R,10R,13R,14S)-9-methyl-5-methylidenetetracyclo[11.2.1.01,10.04,9]hexadecane-14-carboxylic acid |
| SMILES | C=C1CCC[C@]2(C)[C@@H]1CC[C@@]13C[C@@H](CC[C@H]12)[C@@H](C(=O)O)C3 |
| InChI | InChI=1S/C19H28O2/c1-12-4-3-8-18(2)15(12)7-9-19-10-13(5-6-16(18)19)14(11-19)17(20)21/h13-16H,1,3-11H2,2H3,(H,20,21)/t13-,14+,15-,16+,18-,19+/m1/s1 |
| InChIKey | WMEDLAURVXZWQZ-DGUWLTKGSA-N |
| XLogP | 4.65 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.43 |
| LogP ≤ 5 | 4.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|