C25H44N2O6 — CID 162971756
(3R,6R,7S,9S,12S)-3-[(2R)-butan-2-yl]-7-hydroxy-9-[(2R,7S)-7-hydroxyoctan-2-yl]-6-methyl-10-oxa-1,4-diazabicyclo[10.3.0]pentadecane-2,5,11-trione (PubChem CID 162971756) has the molecular formula C25H44N2O6 and a molecular weight of 468.64 g/mol. Its IUPAC name is (3R,6R,7S,9S,12S)-3-[(2R)-butan-2-yl]-7-hydroxy-9-[(2R,7S)-7-hydroxyoctan-2-yl]-6-methyl-10-oxa-1,4-diazabicyclo[10.3.0]pentadecane-2,5,11-trione.
| Compound Name | (3R,6R,7S,9S,12S)-3-[(2R)-butan-2-yl]-7-hydroxy-9-[(2R,7S)-7-hydroxyoctan-2-yl]-6-methyl-10-oxa-1,4-diazabicyclo[10.3.0]pentadecane-2,5,11-trione |
|---|---|
| PubChem CID | 162971756 |
| Molecular Formula | C25H44N2O6 |
| Molecular Weight | 468.64 g/mol |
| Exact Mass | 468.32 |
| IUPAC Name | (3R,6R,7S,9S,12S)-3-[(2R)-butan-2-yl]-7-hydroxy-9-[(2R,7S)-7-hydroxyoctan-2-yl]-6-methyl-10-oxa-1,4-diazabicyclo[10.3.0]pentadecane-2,5,11-trione |
| SMILES | CC[C@@H](C)[C@H]1NC(=O)[C@H](C)[C@@H](O)C[C@@H]([C@H](C)CCCC[C@H](C)O)OC(=O)[C@@H]2CCCN2C1=O |
| InChI | InChI=1S/C25H44N2O6/c1-6-15(2)22-24(31)27-13-9-12-19(27)25(32)33-21(14-20(29)18(5)23(30)26-22)16(3)10-7-8-11-17(4)28/h15-22,28-29H,6-14H2,1-5H3,(H,26,30)/t15-,16-,17+,18-,19+,20+,21+,22-/m1/s1 |
| InChIKey | QOCRZHBXYGQZJC-XQJOZJDQSA-N |
| XLogP | 2.40 |
| TPSA | 116.17 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.64 |
| LogP ≤ 5 | 2.40 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|