C17H30O4 — CID 162971814
(1S,4S)-3-undecylcyclohexa-2,5-diene-1,2,4,5-tetrol (PubChem CID 162971814) has the molecular formula C17H30O4 and a molecular weight of 298.42 g/mol. Its IUPAC name is (1S,4S)-3-undecylcyclohexa-2,5-diene-1,2,4,5-tetrol.
| Compound Name | (1S,4S)-3-undecylcyclohexa-2,5-diene-1,2,4,5-tetrol |
|---|---|
| PubChem CID | 162971814 |
| Molecular Formula | C17H30O4 |
| Molecular Weight | 298.42 g/mol |
| Exact Mass | 298.21 |
| IUPAC Name | (1S,4S)-3-undecylcyclohexa-2,5-diene-1,2,4,5-tetrol |
| SMILES | CCCCCCCCCCCC1=C(O)[C@@H](O)C=C(O)[C@H]1O |
| InChI | InChI=1S/C17H30O4/c1-2-3-4-5-6-7-8-9-10-11-13-16(20)14(18)12-15(19)17(13)21/h12,14,17-21H,2-11H2,1H3/t14-,17-/m0/s1 |
| InChIKey | DXYGFEDLPPKUBI-YOEHRIQHSA-N |
| XLogP | 3.90 |
| TPSA | 80.92 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.42 |
| LogP ≤ 5 | 3.90 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|