C16H20O3 — CID 162971953
(6aR,7S,9S,9aR)-7-methoxy-3,6,9-trimethyl-7,8,9,9a-tetrahydro-6aH-azuleno[4,5-b]furan-4-one (PubChem CID 162971953) has the molecular formula C16H20O3 and a molecular weight of 260.33 g/mol. Its IUPAC name is (6aR,7S,9S,9aR)-7-methoxy-3,6,9-trimethyl-7,8,9,9a-tetrahydro-6aH-azuleno[4,5-b]furan-4-one.
| Compound Name | (6aR,7S,9S,9aR)-7-methoxy-3,6,9-trimethyl-7,8,9,9a-tetrahydro-6aH-azuleno[4,5-b]furan-4-one |
|---|---|
| PubChem CID | 162971953 |
| Molecular Formula | C16H20O3 |
| Molecular Weight | 260.33 g/mol |
| Exact Mass | 260.14 |
| IUPAC Name | (6aR,7S,9S,9aR)-7-methoxy-3,6,9-trimethyl-7,8,9,9a-tetrahydro-6aH-azuleno[4,5-b]furan-4-one |
| SMILES | CO[C@H]1C[C@H](C)[C@H]2c3occ(C)c3C(=O)C=C(C)[C@@H]21 |
| InChI | InChI=1S/C16H20O3/c1-8-5-11(17)13-10(3)7-19-16(13)15-9(2)6-12(18-4)14(8)15/h5,7,9,12,14-15H,6H2,1-4H3/t9-,12-,14+,15+/m0/s1 |
| InChIKey | CRFQMYMTPWUTGB-JQWOWJDXSA-N |
| XLogP | 3.49 |
| TPSA | 39.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.33 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |