C22H18Cl3NO4 — CID 162971990
(13S)-2,3-dimethoxy-12-methyl-13-(trichloromethyl)-13H-[1,3]benzodioxolo[5,6-c]phenanthridine (PubChem CID 162971990) has the molecular formula C22H18Cl3NO4 and a molecular weight of 466.75 g/mol. Its IUPAC name is (13S)-2,3-dimethoxy-12-methyl-13-(trichloromethyl)-13H-[1,3]benzodioxolo[5,6-c]phenanthridine.
| Compound Name | (13S)-2,3-dimethoxy-12-methyl-13-(trichloromethyl)-13H-[1,3]benzodioxolo[5,6-c]phenanthridine |
|---|---|
| PubChem CID | 162971990 |
| Molecular Formula | C22H18Cl3NO4 |
| Molecular Weight | 466.75 g/mol |
| Exact Mass | 465.03 |
| IUPAC Name | (13S)-2,3-dimethoxy-12-methyl-13-(trichloromethyl)-13H-[1,3]benzodioxolo[5,6-c]phenanthridine |
| SMILES | COc1cc2c(cc1OC)[C@@H](C(Cl)(Cl)Cl)N(C)c1c-2ccc2cc3c(cc12)OCO3 |
| InChI | InChI=1S/C22H18Cl3NO4/c1-26-20-12(5-4-11-6-18-19(7-13(11)20)30-10-29-18)14-8-16(27-2)17(28-3)9-15(14)21(26)22(23,24)25/h4-9,21H,10H2,1-3H3/t21-/m0/s1 |
| InChIKey | QRGVYZWKDZYPOJ-NRFANRHFSA-N |
| XLogP | 6.11 |
| TPSA | 40.16 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.75 |
| LogP ≤ 5 | 6.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|