C40H55NO3 — CID 162972031
CID 162972031 (PubChem CID 162972031) has the molecular formula C40H55NO3 and a molecular weight of 597.88 g/mol.
| Compound Name | CID 162972031 |
|---|---|
| PubChem CID | 162972031 |
| Molecular Formula | C40H55NO3 |
| Molecular Weight | 597.88 g/mol |
| Exact Mass | 597.42 |
| IUPAC Name | — |
| SMILES | C[C@@]12CCC[C@@]34CC[C@@H](CO)[C@@](N)([C@@H]31)[C@H]1C#CC3(CCCCC3)c3cc(O)ccc3C[C@H]3C[C@H](CC5(CCCC5)C3)[C@@]1(C4)O2 |
| InChI | InChI=1S/C40H55NO3/c1-35-12-7-17-38-18-10-29(25-42)40(41,34(35)38)33-11-19-37(15-3-2-4-16-37)32-22-31(43)9-8-28(32)20-27-21-30(39(33,26-38)44-35)24-36(23-27)13-5-6-14-36/h8-9,22,27,29-30,33-34,42-43H,2-7,10,12-18,20-21,23-26,41H2,1H3/t27-,29-,30+,33-,34+,35+,38-,39+,40-/m0/s1 |
| InChIKey | AOSLNJQHZAQLAJ-SIGNKAQXSA-N |
| XLogP | 7.56 |
| TPSA | 75.71 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 597.88 |
| LogP ≤ 5 | 7.56 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|