C33H50O7 — CID 162972476
5-[(2R,3S,6S,8R,9S)-3-butyl-8-[(6S,7S)-6-hydroxy-10-methoxy-3,7-dimethyl-10-oxodeca-2,4,8-trienyl]-9-methyl-1,7-dioxaspiro[5.5]undecan-2-yl]-3-methylpenta-2,4-dienoic acid (PubChem CID 162972476) has the molecular formula C33H50O7 and a molecular weight of 558.76 g/mol. Its IUPAC name is 5-[(2R,3S,6S,8R,9S)-3-butyl-8-[(6S,7S)-6-hydroxy-10-methoxy-3,7-dimethyl-10-oxodeca-2,4,8-trienyl]-9-methyl-1,7-dioxaspiro[5.5]undecan-2-yl]-3-methylpenta-2,4-dienoic acid.
| Compound Name | 5-[(2R,3S,6S,8R,9S)-3-butyl-8-[(6S,7S)-6-hydroxy-10-methoxy-3,7-dimethyl-10-oxodeca-2,4,8-trienyl]-9-methyl-1,7-dioxaspiro[5.5]undecan-2-yl]-3-methylpenta-2,4-dienoic acid |
|---|---|
| PubChem CID | 162972476 |
| Molecular Formula | C33H50O7 |
| Molecular Weight | 558.76 g/mol |
| Exact Mass | 558.36 |
| IUPAC Name | 5-[(2R,3S,6S,8R,9S)-3-butyl-8-[(6S,7S)-6-hydroxy-10-methoxy-3,7-dimethyl-10-oxodeca-2,4,8-trienyl]-9-methyl-1,7-dioxaspiro[5.5]undecan-2-yl]-3-methylpenta-2,4-dienoic acid |
| SMILES | CCCC[C@H]1CC[C@]2(CC[C@H](C)[C@@H](CC=C(C)C=C[C@H](O)[C@@H](C)C=CC(=O)OC)O2)O[C@H]1C=CC(C)=CC(=O)O |
| InChI | InChI=1S/C33H50O7/c1-7-8-9-27-19-21-33(40-30(27)16-12-24(3)22-31(35)36)20-18-26(5)29(39-33)15-11-23(2)10-14-28(34)25(4)13-17-32(37)38-6/h10-14,16-17,22,25-30,34H,7-9,15,18-21H2,1-6H3,(H,35,36)/t25-,26-,27-,28-,29+,30-,33-/m0/s1 |
| InChIKey | QCTPJZZHHCIENT-ALAZLSMVSA-N |
| XLogP | 6.69 |
| TPSA | 102.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 558.76 |
| LogP ≤ 5 | 6.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|