C8H12O8 — CID 162972821
(1S,3R)-1,3-dihydroxypentane-1,3,5-tricarboxylic acid (PubChem CID 162972821) has the molecular formula C8H12O8 and a molecular weight of 236.18 g/mol. Its IUPAC name is (1S,3R)-1,3-dihydroxypentane-1,3,5-tricarboxylic acid.
| Compound Name | (1S,3R)-1,3-dihydroxypentane-1,3,5-tricarboxylic acid |
|---|---|
| PubChem CID | 162972821 |
| Molecular Formula | C8H12O8 |
| Molecular Weight | 236.18 g/mol |
| Exact Mass | 236.05 |
| IUPAC Name | (1S,3R)-1,3-dihydroxypentane-1,3,5-tricarboxylic acid |
| SMILES | O=C(O)CC[C@@](O)(C[C@H](O)C(=O)O)C(=O)O |
| InChI | InChI=1S/C8H12O8/c9-4(6(12)13)3-8(16,7(14)15)2-1-5(10)11/h4,9,16H,1-3H2,(H,10,11)(H,12,13)(H,14,15)/t4-,8+/m0/s1 |
| InChIKey | CQBQTNMBPLCAHQ-RNHFCUEFSA-N |
| XLogP | -1.50 |
| TPSA | 152.36 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 236.18 |
| LogP ≤ 5 | -1.50 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |