C15H24O3 — CID 162972846
1-(1-hydroxypropan-2-yl)-4,7-dimethyl-1,2,4a,5,6,8a-hexahydronaphthalene-2,6-diol (PubChem CID 162972846) has the molecular formula C15H24O3 and a molecular weight of 252.35 g/mol. Its IUPAC name is 1-(1-hydroxypropan-2-yl)-4,7-dimethyl-1,2,4a,5,6,8a-hexahydronaphthalene-2,6-diol.
| Compound Name | 1-(1-hydroxypropan-2-yl)-4,7-dimethyl-1,2,4a,5,6,8a-hexahydronaphthalene-2,6-diol |
|---|---|
| PubChem CID | 162972846 |
| Molecular Formula | C15H24O3 |
| Molecular Weight | 252.35 g/mol |
| Exact Mass | 252.17 |
| IUPAC Name | 1-(1-hydroxypropan-2-yl)-4,7-dimethyl-1,2,4a,5,6,8a-hexahydronaphthalene-2,6-diol |
| SMILES | CC1=CC2C(CC1O)C(C)=CC(O)C2C(C)CO |
| InChI | InChI=1S/C15H24O3/c1-8-5-14(18)15(10(3)7-16)12-4-9(2)13(17)6-11(8)12/h4-5,10-18H,6-7H2,1-3H3 |
| InChIKey | VBJDHIYJUUBFBR-UHFFFAOYSA-N |
| XLogP | 1.50 |
| TPSA | 60.69 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.35 |
| LogP ≤ 5 | 1.50 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|