C15H20O4 — CID 162973233
7-hepta-1,3,5-trienyl-2,6,8-trioxatricyclo[5.3.1.04,11]undecan-4-ol (PubChem CID 162973233) has the molecular formula C15H20O4 and a molecular weight of 264.32 g/mol. Its IUPAC name is 7-hepta-1,3,5-trienyl-2,6,8-trioxatricyclo[5.3.1.04,11]undecan-4-ol.
| Compound Name | 7-hepta-1,3,5-trienyl-2,6,8-trioxatricyclo[5.3.1.04,11]undecan-4-ol |
|---|---|
| PubChem CID | 162973233 |
| Molecular Formula | C15H20O4 |
| Molecular Weight | 264.32 g/mol |
| Exact Mass | 264.14 |
| IUPAC Name | 7-hepta-1,3,5-trienyl-2,6,8-trioxatricyclo[5.3.1.04,11]undecan-4-ol |
| SMILES | CC=CC=CC=CC12OCCC3OCC(O)(CO1)C32 |
| InChI | InChI=1S/C15H20O4/c1-2-3-4-5-6-8-15-13-12(7-9-18-15)17-10-14(13,16)11-19-15/h2-6,8,12-13,16H,7,9-11H2,1H3 |
| InChIKey | BUGIOXBGPVUSDA-UHFFFAOYSA-N |
| XLogP | 1.57 |
| TPSA | 47.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.32 |
| LogP ≤ 5 | 1.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|