C24H32O3 — CID 162973341
[(1R,2S,4aR,5R,8aS)-5-hydroxy-4a,8-dimethyl-2-propan-2-yl-2,3,4,5,6,8a-hexahydro-1H-naphthalen-1-yl] (E)-3-phenylprop-2-enoate (PubChem CID 162973341) has the molecular formula C24H32O3 and a molecular weight of 368.52 g/mol. Its IUPAC name is [(1R,2S,4aR,5R,8aS)-5-hydroxy-4a,8-dimethyl-2-propan-2-yl-2,3,4,5,6,8a-hexahydro-1H-naphthalen-1-yl] (E)-3-phenylprop-2-enoate.
| Compound Name | [(1R,2S,4aR,5R,8aS)-5-hydroxy-4a,8-dimethyl-2-propan-2-yl-2,3,4,5,6,8a-hexahydro-1H-naphthalen-1-yl] (E)-3-phenylprop-2-enoate |
|---|---|
| PubChem CID | 162973341 |
| Molecular Formula | C24H32O3 |
| Molecular Weight | 368.52 g/mol |
| Exact Mass | 368.24 |
| IUPAC Name | [(1R,2S,4aR,5R,8aS)-5-hydroxy-4a,8-dimethyl-2-propan-2-yl-2,3,4,5,6,8a-hexahydro-1H-naphthalen-1-yl] (E)-3-phenylprop-2-enoate |
| SMILES | CC1=CC[C@@H](O)[C@]2(C)CC[C@@H](C(C)C)[C@@H](OC(=O)/C=C/c3ccccc3)[C@@H]12 |
| InChI | InChI=1S/C24H32O3/c1-16(2)19-14-15-24(4)20(25)12-10-17(3)22(24)23(19)27-21(26)13-11-18-8-6-5-7-9-18/h5-11,13,16,19-20,22-23,25H,12,14-15H2,1-4H3/b13-11+/t19-,20+,22+,23+,24-/m0/s1 |
| InChIKey | PJJFRVBMYOIECO-SDIJUFKJSA-N |
| XLogP | 5.01 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.52 |
| LogP ≤ 5 | 5.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|