C25H31N3O4 — CID 162973405
8,15-dihydroxy-7,14-diphenyl-1,6,10-triazabicyclo[11.3.0]hexadecane-9,16-dione (PubChem CID 162973405) has the molecular formula C25H31N3O4 and a molecular weight of 437.54 g/mol. Its IUPAC name is 8,15-dihydroxy-7,14-diphenyl-1,6,10-triazabicyclo[11.3.0]hexadecane-9,16-dione.
| Compound Name | 8,15-dihydroxy-7,14-diphenyl-1,6,10-triazabicyclo[11.3.0]hexadecane-9,16-dione |
|---|---|
| PubChem CID | 162973405 |
| Molecular Formula | C25H31N3O4 |
| Molecular Weight | 437.54 g/mol |
| Exact Mass | 437.23 |
| IUPAC Name | 8,15-dihydroxy-7,14-diphenyl-1,6,10-triazabicyclo[11.3.0]hexadecane-9,16-dione |
| SMILES | O=C1NCCC2C(c3ccccc3)C(O)C(=O)N2CCCCNC(c2ccccc2)C1O |
| InChI | InChI=1S/C25H31N3O4/c29-22-20(17-9-3-1-4-10-17)19-13-15-27-24(31)23(30)21(18-11-5-2-6-12-18)26-14-7-8-16-28(19)25(22)32/h1-6,9-12,19-23,26,29-30H,7-8,13-16H2,(H,27,31) |
| InChIKey | DJVJIXPENPIGEU-UHFFFAOYSA-N |
| XLogP | 1.33 |
| TPSA | 101.90 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.54 |
| LogP ≤ 5 | 1.33 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |