C22H26O8 — CID 162973479
methyl (3aS,4S,5S,6E,10E,11aR)-5-acetyloxy-10-methyl-3-methylidene-4-(2-methylprop-2-enoyloxy)-2-oxo-3a,4,5,8,9,11a-hexahydrocyclodeca[b]furan-6-carboxylate (PubChem CID 162973479) has the molecular formula C22H26O8 and a molecular weight of 418.44 g/mol. Its IUPAC name is methyl (3aS,4S,5S,6E,10E,11aR)-5-acetyloxy-10-methyl-3-methylidene-4-(2-methylprop-2-enoyloxy)-2-oxo-3a,4,5,8,9,11a-hexahydrocyclodeca[b]furan-6-carboxylate.
| Compound Name | methyl (3aS,4S,5S,6E,10E,11aR)-5-acetyloxy-10-methyl-3-methylidene-4-(2-methylprop-2-enoyloxy)-2-oxo-3a,4,5,8,9,11a-hexahydrocyclodeca[b]furan-6-carboxylate |
|---|---|
| PubChem CID | 162973479 |
| Molecular Formula | C22H26O8 |
| Molecular Weight | 418.44 g/mol |
| Exact Mass | 418.16 |
| IUPAC Name | methyl (3aS,4S,5S,6E,10E,11aR)-5-acetyloxy-10-methyl-3-methylidene-4-(2-methylprop-2-enoyloxy)-2-oxo-3a,4,5,8,9,11a-hexahydrocyclodeca[b]furan-6-carboxylate |
| SMILES | C=C(C)C(=O)O[C@H]1[C@H]2C(=C)C(=O)O[C@@H]2/C=C(\C)CC/C=C(/C(=O)OC)[C@@H]1OC(C)=O |
| InChI | InChI=1S/C22H26O8/c1-11(2)20(24)30-19-17-13(4)21(25)29-16(17)10-12(3)8-7-9-15(22(26)27-6)18(19)28-14(5)23/h9-10,16-19H,1,4,7-8H2,2-3,5-6H3/b12-10+,15-9+/t16-,17+,18+,19+/m1/s1 |
| InChIKey | XBBLLENRTSUTSP-PEGIKPHUSA-N |
| XLogP | 2.34 |
| TPSA | 105.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.44 |
| LogP ≤ 5 | 2.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|