C15H24O3 — CID 162973632
(1S,4S,6S,10R,11S)-10-hydroperoxy-4,12,12-trimethyl-9-methylidene-5-oxatricyclo[9.1.0.04,6]dodecane (PubChem CID 162973632) has the molecular formula C15H24O3 and a molecular weight of 252.35 g/mol. Its IUPAC name is (1S,4S,6S,10R,11S)-10-hydroperoxy-4,12,12-trimethyl-9-methylidene-5-oxatricyclo[9.1.0.04,6]dodecane.
| Compound Name | (1S,4S,6S,10R,11S)-10-hydroperoxy-4,12,12-trimethyl-9-methylidene-5-oxatricyclo[9.1.0.04,6]dodecane |
|---|---|
| PubChem CID | 162973632 |
| Molecular Formula | C15H24O3 |
| Molecular Weight | 252.35 g/mol |
| Exact Mass | 252.17 |
| IUPAC Name | (1S,4S,6S,10R,11S)-10-hydroperoxy-4,12,12-trimethyl-9-methylidene-5-oxatricyclo[9.1.0.04,6]dodecane |
| SMILES | C=C1CC[C@@H]2O[C@@]2(C)CC[C@H]2[C@H]([C@H]1OO)C2(C)C |
| InChI | InChI=1S/C15H24O3/c1-9-5-6-11-15(4,17-11)8-7-10-12(13(9)18-16)14(10,2)3/h10-13,16H,1,5-8H2,2-4H3/t10-,11-,12+,13-,15-/m0/s1 |
| InChIKey | GATBZZIYPNKFMJ-AIUMHDJVSA-N |
| XLogP | 3.40 |
| TPSA | 41.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.35 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|