About 8-(2,4-dihydroxy-5,5-dimethyloxolan-3-yl)-7-methoxy-2-phenylchromen-4-one
8-(2,4-dihydroxy-5,5-dimethyloxolan-3-yl)-7-methoxy-2-phenylchromen-4-one (PubChem CID 162974416) has the molecular formula C22H22O6
and a molecular weight of 382.41 g/mol. Its IUPAC name is 8-(2,4-dihydroxy-5,5-dimethyloxolan-3-yl)-7-methoxy-2-phenylchromen-4-one.
Molecular Properties
| Compound Name | 8-(2,4-dihydroxy-5,5-dimethyloxolan-3-yl)-7-methoxy-2-phenylchromen-4-one |
| PubChem CID | 162974416 |
| Molecular Formula | C22H22O6 |
| Molecular Weight | 382.41 g/mol |
| Exact Mass | 382.14 |
| IUPAC Name | 8-(2,4-dihydroxy-5,5-dimethyloxolan-3-yl)-7-methoxy-2-phenylchromen-4-one |
| SMILES | COc1ccc2c(=O)cc(-c3ccccc3)oc2c1C1C(O)OC(C)(C)C1O |
| InChI | InChI=1S/C22H22O6/c1-22(2)20(24)18(21(25)28-22)17-15(26-3)10-9-13-14(23)11-16(27-19(13)17)12-7-5-4-6-8-12/h4-11,18,20-21,24-25H,1-3H3 |
| InChIKey | XOVMVTBGLHJLEX-UHFFFAOYSA-N |
| XLogP | 3.04 |
| TPSA | 89.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 382.41 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 8-(2,4-dihydroxy-5,5-dimethyloxolan-3-yl)-7-methoxy-2-phenylchromen-4-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 8-(2,4-dihydroxy-5,5-dimethyloxolan-3-yl)-7-methoxy-2-phenylchromen-4-one?
The IUPAC name of 8-(2,4-dihydroxy-5,5-dimethyloxolan-3-yl)-7-methoxy-2-phenylchromen-4-one (CID 162974416) is 8-(2,4-dihydroxy-5,5-dimethyloxolan-3-yl)-7-methoxy-2-phenylchromen-4-one.
What is the SMILES notation for 8-(2,4-dihydroxy-5,5-dimethyloxolan-3-yl)-7-methoxy-2-phenylchromen-4-one?
The canonical SMILES for 8-(2,4-dihydroxy-5,5-dimethyloxolan-3-yl)-7-methoxy-2-phenylchromen-4-one is COc1ccc2c(=O)cc(-c3ccccc3)oc2c1C1C(O)OC(C)(C)C1O.
What is the InChIKey of 8-(2,4-dihydroxy-5,5-dimethyloxolan-3-yl)-7-methoxy-2-phenylchromen-4-one?
The InChIKey is XOVMVTBGLHJLEX-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H22O6/c1-22(2)20(24)18(21(25)28-22)17-15(26-3)10-9-13-14(23)11-16(27-19(13)17)12-7-5-4-6-8-12/h4-11,18,20-21,24-25H,1-3H3.
What are the key properties of 8-(2,4-dihydroxy-5,5-dimethyloxolan-3-yl)-7-methoxy-2-phenylchromen-4-one?
8-(2,4-dihydroxy-5,5-dimethyloxolan-3-yl)-7-methoxy-2-phenylchromen-4-one has a molecular weight of 382.41 g/mol, XLogP of 3.04, 3 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 8-(2,4-dihydroxy-5,5-dimethyloxolan-3-yl)-7-methoxy-2-phenylchromen-4-one is sourced from PubChem (CID 162974416), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).