C30H46O4 — CID 162975407
(1S,2R,4aR,4bR,7S,8aR,10aR)-7-hydroxy-4b,8,8,10a-tetramethyl-2-[(2S,4E)-7-methyl-3-oxoocta-4,6-dien-2-yl]spiro[2,3,4,4a,5,6,7,8a,9,10-decahydrophenanthrene-1,4'-oxolane]-2'-one (PubChem CID 162975407) has the molecular formula C30H46O4 and a molecular weight of 470.69 g/mol. Its IUPAC name is (1S,2R,4aR,4bR,7S,8aR,10aR)-7-hydroxy-4b,8,8,10a-tetramethyl-2-[(2S,4E)-7-methyl-3-oxoocta-4,6-dien-2-yl]spiro[2,3,4,4a,5,6,7,8a,9,10-decahydrophenanthrene-1,4'-oxolane]-2'-one.
| Compound Name | (1S,2R,4aR,4bR,7S,8aR,10aR)-7-hydroxy-4b,8,8,10a-tetramethyl-2-[(2S,4E)-7-methyl-3-oxoocta-4,6-dien-2-yl]spiro[2,3,4,4a,5,6,7,8a,9,10-decahydrophenanthrene-1,4'-oxolane]-2'-one |
|---|---|
| PubChem CID | 162975407 |
| Molecular Formula | C30H46O4 |
| Molecular Weight | 470.69 g/mol |
| Exact Mass | 470.34 |
| IUPAC Name | (1S,2R,4aR,4bR,7S,8aR,10aR)-7-hydroxy-4b,8,8,10a-tetramethyl-2-[(2S,4E)-7-methyl-3-oxoocta-4,6-dien-2-yl]spiro[2,3,4,4a,5,6,7,8a,9,10-decahydrophenanthrene-1,4'-oxolane]-2'-one |
| SMILES | CC(C)=C/C=C/C(=O)[C@@H](C)[C@H]1CC[C@@H]2[C@@]3(C)CC[C@H](O)C(C)(C)[C@@H]3CC[C@@]2(C)[C@@]12COC(=O)C2 |
| InChI | InChI=1S/C30H46O4/c1-19(2)9-8-10-22(31)20(3)21-11-12-24-28(6)15-14-25(32)27(4,5)23(28)13-16-29(24,7)30(21)17-26(33)34-18-30/h8-10,20-21,23-25,32H,11-18H2,1-7H3/b10-8+/t20-,21+,23-,24+,25-,28-,29+,30-/m0/s1 |
| InChIKey | YRLHVYMPSHHPDQ-DUOIUPQHSA-N |
| XLogP | 6.28 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.69 |
| LogP ≤ 5 | 6.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|