C31H38O17 — CID 162975734
[5-acetyloxy-6-[2-(3,4-dihydroxyphenyl)-2-hydroxyethoxy]-2-(hydroxymethyl)-4-(3,4,5-trihydroxy-6-methyloxan-2-yl)oxyoxan-3-yl] 3-(3,4-dihydroxyphenyl)prop-2-enoate (PubChem CID 162975734) has the molecular formula C31H38O17 and a molecular weight of 682.63 g/mol. Its IUPAC name is [5-acetyloxy-6-[2-(3,4-dihydroxyphenyl)-2-hydroxyethoxy]-2-(hydroxymethyl)-4-(3,4,5-trihydroxy-6-methyloxan-2-yl)oxyoxan-3-yl] 3-(3,4-dihydroxyphenyl)prop-2-enoate.
| Compound Name | [5-acetyloxy-6-[2-(3,4-dihydroxyphenyl)-2-hydroxyethoxy]-2-(hydroxymethyl)-4-(3,4,5-trihydroxy-6-methyloxan-2-yl)oxyoxan-3-yl] 3-(3,4-dihydroxyphenyl)prop-2-enoate |
|---|---|
| PubChem CID | 162975734 |
| Molecular Formula | C31H38O17 |
| Molecular Weight | 682.63 g/mol |
| Exact Mass | 682.21 |
| IUPAC Name | [5-acetyloxy-6-[2-(3,4-dihydroxyphenyl)-2-hydroxyethoxy]-2-(hydroxymethyl)-4-(3,4,5-trihydroxy-6-methyloxan-2-yl)oxyoxan-3-yl] 3-(3,4-dihydroxyphenyl)prop-2-enoate |
| SMILES | CC(=O)OC1C(OCC(O)c2ccc(O)c(O)c2)OC(CO)C(OC(=O)C=Cc2ccc(O)c(O)c2)C1OC1OC(C)C(O)C(O)C1O |
| InChI | InChI=1S/C31H38O17/c1-13-24(40)25(41)26(42)30(44-13)48-28-27(47-23(39)8-4-15-3-6-17(34)19(36)9-15)22(11-32)46-31(29(28)45-14(2)33)43-12-21(38)16-5-7-18(35)20(37)10-16/h3-10,13,21-22,24-32,34-38,40-42H,11-12H2,1-2H3 |
| InChIKey | AXLWURMCBFXASG-UHFFFAOYSA-N |
| XLogP | -0.95 |
| TPSA | 271.59 Ų |
| H-Bond Donors | 9 |
| H-Bond Acceptors | 17 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 48 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 682.63 |
| LogP ≤ 5 | -0.95 |
| H-Bond Donors ≤ 5 | 9 |
| H-Bond Acceptors ≤ 10 | 17 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|