C22H21NO9 — CID 162976144
14-hydroxy-15-methoxy-4-[(2S,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxy-10-azatetracyclo[7.6.1.02,7.012,16]hexadeca-1,3,5,7,9(16),12,14-heptaen-11-one (PubChem CID 162976144) has the molecular formula C22H21NO9 and a molecular weight of 443.41 g/mol. Its IUPAC name is 14-hydroxy-15-methoxy-4-[(2S,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxy-10-azatetracyclo[7.6.1.02,7.012,16]hexadeca-1,3,5,7,9(16),12,14-heptaen-11-one.
| Compound Name | 14-hydroxy-15-methoxy-4-[(2S,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxy-10-azatetracyclo[7.6.1.02,7.012,16]hexadeca-1,3,5,7,9(16),12,14-heptaen-11-one |
|---|---|
| PubChem CID | 162976144 |
| Molecular Formula | C22H21NO9 |
| Molecular Weight | 443.41 g/mol |
| Exact Mass | 443.12 |
| IUPAC Name | 14-hydroxy-15-methoxy-4-[(2S,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxy-10-azatetracyclo[7.6.1.02,7.012,16]hexadeca-1,3,5,7,9(16),12,14-heptaen-11-one |
| SMILES | COc1c(O)cc2c3c(cc4ccc(O[C@@H]5O[C@H](CO)[C@@H](O)[C@H](O)[C@H]5O)cc4c13)NC2=O |
| InChI | InChI=1S/C22H21NO9/c1-30-20-13(25)6-11-15-12(23-21(11)29)4-8-2-3-9(5-10(8)16(15)20)31-22-19(28)18(27)17(26)14(7-24)32-22/h2-6,14,17-19,22,24-28H,7H2,1H3,(H,23,29)/t14-,17-,18+,19-,22-/m1/s1 |
| InChIKey | OELDBESAYZDHRI-MAEOEUOPSA-N |
| XLogP | 0.45 |
| TPSA | 157.94 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.41 |
| LogP ≤ 5 | 0.45 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|