C22H36O3 — CID 162976256
methyl 5-(6-hydroxy-4-methylhex-4-enyl)-1,4a-dimethyl-6-methylidene-3,4,5,7,8,8a-hexahydro-2H-naphthalene-1-carboxylate (PubChem CID 162976256) has the molecular formula C22H36O3 and a molecular weight of 348.53 g/mol. Its IUPAC name is methyl 5-(6-hydroxy-4-methylhex-4-enyl)-1,4a-dimethyl-6-methylidene-3,4,5,7,8,8a-hexahydro-2H-naphthalene-1-carboxylate.
| Compound Name | methyl 5-(6-hydroxy-4-methylhex-4-enyl)-1,4a-dimethyl-6-methylidene-3,4,5,7,8,8a-hexahydro-2H-naphthalene-1-carboxylate |
|---|---|
| PubChem CID | 162976256 |
| Molecular Formula | C22H36O3 |
| Molecular Weight | 348.53 g/mol |
| Exact Mass | 348.27 |
| IUPAC Name | methyl 5-(6-hydroxy-4-methylhex-4-enyl)-1,4a-dimethyl-6-methylidene-3,4,5,7,8,8a-hexahydro-2H-naphthalene-1-carboxylate |
| SMILES | C=C1CCC2C(C)(C(=O)OC)CCCC2(C)C1CCCC(C)=CCO |
| InChI | InChI=1S/C22H36O3/c1-16(12-15-23)8-6-9-18-17(2)10-11-19-21(18,3)13-7-14-22(19,4)20(24)25-5/h12,18-19,23H,2,6-11,13-15H2,1,3-5H3 |
| InChIKey | RQPSFUSQKQJYDK-UHFFFAOYSA-N |
| XLogP | 5.05 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.53 |
| LogP ≤ 5 | 5.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|