C30H46O5 — CID 162977584
(1R,4aR,6aR,6aS,6bR,8aS,10R,11R,12aS)-1,10,11-trihydroxy-2,2,6a,6b,9,9,12a-heptamethyl-1,3,4,5,6,6a,7,8,8a,10,11,12-dodecahydropicene-4a-carboxylic acid (PubChem CID 162977584) has the molecular formula C30H46O5 and a molecular weight of 486.69 g/mol. Its IUPAC name is (1R,4aR,6aR,6aS,6bR,8aS,10R,11R,12aS)-1,10,11-trihydroxy-2,2,6a,6b,9,9,12a-heptamethyl-1,3,4,5,6,6a,7,8,8a,10,11,12-dodecahydropicene-4a-carboxylic acid.
| Compound Name | (1R,4aR,6aR,6aS,6bR,8aS,10R,11R,12aS)-1,10,11-trihydroxy-2,2,6a,6b,9,9,12a-heptamethyl-1,3,4,5,6,6a,7,8,8a,10,11,12-dodecahydropicene-4a-carboxylic acid |
|---|---|
| PubChem CID | 162977584 |
| Molecular Formula | C30H46O5 |
| Molecular Weight | 486.69 g/mol |
| Exact Mass | 486.33 |
| IUPAC Name | (1R,4aR,6aR,6aS,6bR,8aS,10R,11R,12aS)-1,10,11-trihydroxy-2,2,6a,6b,9,9,12a-heptamethyl-1,3,4,5,6,6a,7,8,8a,10,11,12-dodecahydropicene-4a-carboxylic acid |
| SMILES | CC1(C)CC[C@]2(C(=O)O)CC[C@]3(C)C(=C2[C@@H]1O)C=C[C@@H]1[C@@]2(C)C[C@@H](O)[C@H](O)C(C)(C)[C@H]2CC[C@]13C |
| InChI | InChI=1S/C30H46O5/c1-25(2)12-14-30(24(34)35)15-13-28(6)17(21(30)23(25)33)8-9-20-27(5)16-18(31)22(32)26(3,4)19(27)10-11-29(20,28)7/h8-9,18-20,22-23,31-33H,10-16H2,1-7H3,(H,34,35)/t18-,19-,20-,22+,23+,27+,28-,29-,30+/m1/s1 |
| InChIKey | UWGUURZRNLDUKU-VRHRBPNCSA-N |
| XLogP | 5.10 |
| TPSA | 97.99 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.69 |
| LogP ≤ 5 | 5.10 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |