C25H42 — CID 162978169
(6Z,9E,10R)-2,6,10,14-tetramethyl-9-[(3S)-3-methylpent-4-enylidene]pentadeca-2,6,13-triene (PubChem CID 162978169) has the molecular formula C25H42 and a molecular weight of 342.61 g/mol. Its IUPAC name is (6Z,9E,10R)-2,6,10,14-tetramethyl-9-[(3S)-3-methylpent-4-enylidene]pentadeca-2,6,13-triene.
| Compound Name | (6Z,9E,10R)-2,6,10,14-tetramethyl-9-[(3S)-3-methylpent-4-enylidene]pentadeca-2,6,13-triene |
|---|---|
| PubChem CID | 162978169 |
| Molecular Formula | C25H42 |
| Molecular Weight | 342.61 g/mol |
| Exact Mass | 342.33 |
| IUPAC Name | (6Z,9E,10R)-2,6,10,14-tetramethyl-9-[(3S)-3-methylpent-4-enylidene]pentadeca-2,6,13-triene |
| SMILES | C=C[C@@H](C)C/C=C(\C/C=C(/C)CCC=C(C)C)[C@H](C)CCC=C(C)C |
| InChI | InChI=1S/C25H42/c1-9-22(6)16-18-25(24(8)15-11-13-21(4)5)19-17-23(7)14-10-12-20(2)3/h9,12-13,17-18,22,24H,1,10-11,14-16,19H2,2-8H3/b23-17-,25-18+/t22-,24-/m1/s1 |
| InChIKey | VDOFLWFFQCRKTK-JHBVBHIGSA-N |
| XLogP | 8.59 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 12 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.61 |
| LogP ≤ 5 | 8.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|