C23H34O4 — CID 162978269
(1R,2S,4S,5S,9S,10S,12R,13S,14S)-2-acetyloxy-5,9,12,13-tetramethylpentacyclo[11.2.1.01,10.04,9.012,14]hexadecane-5-carboxylic acid (PubChem CID 162978269) has the molecular formula C23H34O4 and a molecular weight of 374.52 g/mol. Its IUPAC name is (1R,2S,4S,5S,9S,10S,12R,13S,14S)-2-acetyloxy-5,9,12,13-tetramethylpentacyclo[11.2.1.01,10.04,9.012,14]hexadecane-5-carboxylic acid.
| Compound Name | (1R,2S,4S,5S,9S,10S,12R,13S,14S)-2-acetyloxy-5,9,12,13-tetramethylpentacyclo[11.2.1.01,10.04,9.012,14]hexadecane-5-carboxylic acid |
|---|---|
| PubChem CID | 162978269 |
| Molecular Formula | C23H34O4 |
| Molecular Weight | 374.52 g/mol |
| Exact Mass | 374.25 |
| IUPAC Name | (1R,2S,4S,5S,9S,10S,12R,13S,14S)-2-acetyloxy-5,9,12,13-tetramethylpentacyclo[11.2.1.01,10.04,9.012,14]hexadecane-5-carboxylic acid |
| SMILES | CC(=O)O[C@H]1C[C@H]2[C@@](C)(CCC[C@]2(C)C(=O)O)[C@@H]2C[C@]3(C)[C@@H]4C[C@]12C[C@@]43C |
| InChI | InChI=1S/C23H34O4/c1-13(24)27-17-9-14-19(2,7-6-8-20(14,3)18(25)26)15-10-21(4)16-11-23(15,17)12-22(16,21)5/h14-17H,6-12H2,1-5H3,(H,25,26)/t14-,15-,16-,17-,19+,20-,21+,22-,23+/m0/s1 |
| InChIKey | NLDXAZWXVUJQQN-LDMDYXHZSA-N |
| XLogP | 4.66 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.52 |
| LogP ≤ 5 | 4.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |