C20H26O4 — CID 162978824
(1R,5R,6S)-5-[2-(furan-3-yl)-2-oxoethyl]-1,5,6-trimethyl-2,3,4,6,7,8-hexahydronaphthalene-1-carboxylic acid (PubChem CID 162978824) has the molecular formula C20H26O4 and a molecular weight of 330.42 g/mol. Its IUPAC name is (1R,5R,6S)-5-[2-(furan-3-yl)-2-oxoethyl]-1,5,6-trimethyl-2,3,4,6,7,8-hexahydronaphthalene-1-carboxylic acid.
| Compound Name | (1R,5R,6S)-5-[2-(furan-3-yl)-2-oxoethyl]-1,5,6-trimethyl-2,3,4,6,7,8-hexahydronaphthalene-1-carboxylic acid |
|---|---|
| PubChem CID | 162978824 |
| Molecular Formula | C20H26O4 |
| Molecular Weight | 330.42 g/mol |
| Exact Mass | 330.18 |
| IUPAC Name | (1R,5R,6S)-5-[2-(furan-3-yl)-2-oxoethyl]-1,5,6-trimethyl-2,3,4,6,7,8-hexahydronaphthalene-1-carboxylic acid |
| SMILES | C[C@H]1CCC2=C(CCC[C@@]2(C)C(=O)O)[C@]1(C)CC(=O)c1ccoc1 |
| InChI | InChI=1S/C20H26O4/c1-13-6-7-16-15(5-4-9-19(16,2)18(22)23)20(13,3)11-17(21)14-8-10-24-12-14/h8,10,12-13H,4-7,9,11H2,1-3H3,(H,22,23)/t13-,19+,20+/m0/s1 |
| InChIKey | UYLPOJLFURHUGB-CJMONDIMSA-N |
| XLogP | 4.86 |
| TPSA | 67.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.42 |
| LogP ≤ 5 | 4.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|