About 2-(2-oxo-8,9-dihydrofuro[2,3-h]chromen-8-yl)propan-2-yl propanoate
2-(2-oxo-8,9-dihydrofuro[2,3-h]chromen-8-yl)propan-2-yl propanoate (PubChem CID 162979060) has the molecular formula C17H18O5
and a molecular weight of 302.33 g/mol. Its IUPAC name is 2-(2-oxo-8,9-dihydrofuro[2,3-h]chromen-8-yl)propan-2-yl propanoate.
Molecular Properties
| Compound Name | 2-(2-oxo-8,9-dihydrofuro[2,3-h]chromen-8-yl)propan-2-yl propanoate |
| PubChem CID | 162979060 |
| Molecular Formula | C17H18O5 |
| Molecular Weight | 302.33 g/mol |
| Exact Mass | 302.12 |
| IUPAC Name | 2-(2-oxo-8,9-dihydrofuro[2,3-h]chromen-8-yl)propan-2-yl propanoate |
| SMILES | CCC(=O)OC(C)(C)C1Cc2c(ccc3ccc(=O)oc23)O1 |
| InChI | InChI=1S/C17H18O5/c1-4-14(18)22-17(2,3)13-9-11-12(20-13)7-5-10-6-8-15(19)21-16(10)11/h5-8,13H,4,9H2,1-3H3 |
| InChIKey | ZHPCIDFYPMOPEF-UHFFFAOYSA-N |
| XLogP | 2.83 |
| TPSA | 65.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 302.33 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|
Analyze 2-(2-oxo-8,9-dihydrofuro[2,3-h]chromen-8-yl)propan-2-yl propanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(2-oxo-8,9-dihydrofuro[2,3-h]chromen-8-yl)propan-2-yl propanoate?
The IUPAC name of 2-(2-oxo-8,9-dihydrofuro[2,3-h]chromen-8-yl)propan-2-yl propanoate (CID 162979060) is 2-(2-oxo-8,9-dihydrofuro[2,3-h]chromen-8-yl)propan-2-yl propanoate.
What is the SMILES notation for 2-(2-oxo-8,9-dihydrofuro[2,3-h]chromen-8-yl)propan-2-yl propanoate?
The canonical SMILES for 2-(2-oxo-8,9-dihydrofuro[2,3-h]chromen-8-yl)propan-2-yl propanoate is CCC(=O)OC(C)(C)C1Cc2c(ccc3ccc(=O)oc23)O1.
What is the InChIKey of 2-(2-oxo-8,9-dihydrofuro[2,3-h]chromen-8-yl)propan-2-yl propanoate?
The InChIKey is ZHPCIDFYPMOPEF-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H18O5/c1-4-14(18)22-17(2,3)13-9-11-12(20-13)7-5-10-6-8-15(19)21-16(10)11/h5-8,13H,4,9H2,1-3H3.
What are the key properties of 2-(2-oxo-8,9-dihydrofuro[2,3-h]chromen-8-yl)propan-2-yl propanoate?
2-(2-oxo-8,9-dihydrofuro[2,3-h]chromen-8-yl)propan-2-yl propanoate has a molecular weight of 302.33 g/mol, XLogP of 2.83, 3 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(2-oxo-8,9-dihydrofuro[2,3-h]chromen-8-yl)propan-2-yl propanoate is sourced from PubChem (CID 162979060), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).