C24H40NO9P — CID 162980119
(2Z,5R,6E,8R,9R,12Z,14Z)-15-cyclohexyl-4-(dimethylamino)-5,8,11-trihydroxy-8-methyl-9-phosphonooxypentadeca-2,6,12,14-tetraenoic acid (PubChem CID 162980119) has the molecular formula C24H40NO9P and a molecular weight of 517.56 g/mol. Its IUPAC name is (2Z,5R,6E,8R,9R,12Z,14Z)-15-cyclohexyl-4-(dimethylamino)-5,8,11-trihydroxy-8-methyl-9-phosphonooxypentadeca-2,6,12,14-tetraenoic acid.
| Compound Name | (2Z,5R,6E,8R,9R,12Z,14Z)-15-cyclohexyl-4-(dimethylamino)-5,8,11-trihydroxy-8-methyl-9-phosphonooxypentadeca-2,6,12,14-tetraenoic acid |
|---|---|
| PubChem CID | 162980119 |
| Molecular Formula | C24H40NO9P |
| Molecular Weight | 517.56 g/mol |
| Exact Mass | 517.24 |
| IUPAC Name | (2Z,5R,6E,8R,9R,12Z,14Z)-15-cyclohexyl-4-(dimethylamino)-5,8,11-trihydroxy-8-methyl-9-phosphonooxypentadeca-2,6,12,14-tetraenoic acid |
| SMILES | CN(C)C(/C=C\C(=O)O)[C@H](O)/C=C/[C@@](C)(O)[C@@H](CC(O)/C=C\C=C/C1CCCCC1)OP(=O)(O)O |
| InChI | InChI=1S/C24H40NO9P/c1-24(30,16-15-21(27)20(25(2)3)13-14-23(28)29)22(34-35(31,32)33)17-19(26)12-8-7-11-18-9-5-4-6-10-18/h7-8,11-16,18-22,26-27,30H,4-6,9-10,17H2,1-3H3,(H,28,29)(H2,31,32,33)/b11-7-,12-8-,14-13-,16-15+/t19?,20?,21-,22-,24-/m1/s1 |
| InChIKey | JQMRWKPAJQOQLP-ODPXWWGOSA-N |
| XLogP | 2.15 |
| TPSA | 167.99 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 517.56 |
| LogP ≤ 5 | 2.15 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|