C19H38O10 — CID 162980397
(2R,3S,4S,5R,6R)-3,4,5-trimethoxy-2-(methoxymethyl)-6-[(2S,3S,4S)-1,3,4,5-tetramethoxypentan-2-yl]oxyoxane (PubChem CID 162980397) has the molecular formula C19H38O10 and a molecular weight of 426.50 g/mol. Its IUPAC name is (2R,3S,4S,5R,6R)-3,4,5-trimethoxy-2-(methoxymethyl)-6-[(2S,3S,4S)-1,3,4,5-tetramethoxypentan-2-yl]oxyoxane.
| Compound Name | (2R,3S,4S,5R,6R)-3,4,5-trimethoxy-2-(methoxymethyl)-6-[(2S,3S,4S)-1,3,4,5-tetramethoxypentan-2-yl]oxyoxane |
|---|---|
| PubChem CID | 162980397 |
| Molecular Formula | C19H38O10 |
| Molecular Weight | 426.50 g/mol |
| Exact Mass | 426.25 |
| IUPAC Name | (2R,3S,4S,5R,6R)-3,4,5-trimethoxy-2-(methoxymethyl)-6-[(2S,3S,4S)-1,3,4,5-tetramethoxypentan-2-yl]oxyoxane |
| SMILES | COC[C@H](OC)[C@H](OC)[C@H](COC)O[C@@H]1O[C@H](COC)[C@H](OC)[C@H](OC)[C@H]1OC |
| InChI | InChI=1S/C19H38O10/c1-20-9-12(23-4)15(24-5)13(10-21-2)28-19-18(27-8)17(26-7)16(25-6)14(29-19)11-22-3/h12-19H,9-11H2,1-8H3/t12-,13-,14+,15-,16-,17-,18+,19+/m0/s1 |
| InChIKey | ZUNVPNBFBAFOBX-FBLCMHPESA-N |
| XLogP | 0.11 |
| TPSA | 92.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.50 |
| LogP ≤ 5 | 0.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |